C17H25NO2S — CID 135072030
(NE,R)-2-methyl-N-[6-(4-methylphenyl)-6-oxohexylidene]propane-2-sulfinamide (PubChem CID 135072030) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-[6-(4-methylphenyl)-6-oxohexylidene]propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-[6-(4-methylphenyl)-6-oxohexylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 135072030 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (NE,R)-2-methyl-N-[6-(4-methylphenyl)-6-oxohexylidene]propane-2-sulfinamide |
| SMILES | Cc1ccc(C(=O)CCCC/C=N/[S@](=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25NO2S/c1-14-9-11-15(12-10-14)16(19)8-6-5-7-13-18-21(20)17(2,3)4/h9-13H,5-8H2,1-4H3/b18-13+/t21-/m1/s1 |
| InChIKey | IAVHFAMTGJXYDD-DILWRCETSA-N |
| XLogP | 4.27 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|