C8H16ClNOS — CID 57333504
(NE,R)-N-(4-chlorobutylidene)-2-methylpropane-2-sulfinamide (PubChem CID 57333504) has the molecular formula C8H16ClNOS and a molecular weight of 209.74 g/mol. Its IUPAC name is (NE,R)-N-(4-chlorobutylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-(4-chlorobutylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 57333504 |
| Molecular Formula | C8H16ClNOS |
| Molecular Weight | 209.74 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | (NE,R)-N-(4-chlorobutylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C/CCCCl |
| InChI | InChI=1S/C8H16ClNOS/c1-8(2,3)12(11)10-7-5-4-6-9/h7H,4-6H2,1-3H3/b10-7+/t12-/m1/s1 |
| InChIKey | PLAQYIKYFXDAQI-OFFHKIPUSA-N |
| XLogP | 2.54 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.74 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|