C13H27NOS — CID 11265085
(NE,S)-2-methyl-N-nonylidenepropane-2-sulfinamide (PubChem CID 11265085) has the molecular formula C13H27NOS and a molecular weight of 245.43 g/mol. Its IUPAC name is (NE,S)-2-methyl-N-nonylidenepropane-2-sulfinamide.
| Compound Name | (NE,S)-2-methyl-N-nonylidenepropane-2-sulfinamide |
|---|---|
| PubChem CID | 11265085 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (NE,S)-2-methyl-N-nonylidenepropane-2-sulfinamide |
| SMILES | CCCCCCCC/C=N/[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C13H27NOS/c1-5-6-7-8-9-10-11-12-14-16(15)13(2,3)4/h12H,5-11H2,1-4H3/b14-12+/t16-/m0/s1 |
| InChIKey | DQUXDGMZFNDHPV-GRNBYLDVSA-N |
| XLogP | 4.27 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|