C15H23NOS — CID 134998927
(NE,S)-N-hexylidene-2,4,6-trimethylbenzenesulfinamide (PubChem CID 134998927) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is (NE,S)-N-hexylidene-2,4,6-trimethylbenzenesulfinamide.
| Compound Name | (NE,S)-N-hexylidene-2,4,6-trimethylbenzenesulfinamide |
|---|---|
| PubChem CID | 134998927 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (NE,S)-N-hexylidene-2,4,6-trimethylbenzenesulfinamide |
| SMILES | CCCCC/C=N/[S@@](=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H23NOS/c1-5-6-7-8-9-16-18(17)15-13(3)10-12(2)11-14(15)4/h9-11H,5-8H2,1-4H3/b16-9+/t18-/m0/s1 |
| InChIKey | YYYCYPHXSMNBHY-WBNHJWIASA-N |
| XLogP | 4.29 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|