C29H42O2 — CID 54466763
(2,4,6-trimethylphenyl) icosa-4,8,11,14-tetraenoate (PubChem CID 54466763) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) icosa-4,8,11,14-tetraenoate.
| Compound Name | (2,4,6-trimethylphenyl) icosa-4,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 54466763 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | (2,4,6-trimethylphenyl) icosa-4,8,11,14-tetraenoate |
| SMILES | CCCCCC=CCC=CCC=CCCC=CCCC(=O)Oc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C29H42O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-28(30)31-29-26(3)23-25(2)24-27(29)4/h9-10,12-13,15-16,19-20,23-24H,5-8,11,14,17-18,21-22H2,1-4H3 |
| InChIKey | XFKVOPLEIQFDRI-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|