C29H40O2 — CID 88761657
(2,4,6-trimethylphenyl) (2E,4Z,6E,8Z,10Z)-icosa-2,4,6,8,10-pentaenoate (PubChem CID 88761657) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) (2E,4Z,6E,8Z,10Z)-icosa-2,4,6,8,10-pentaenoate.
| Compound Name | (2,4,6-trimethylphenyl) (2E,4Z,6E,8Z,10Z)-icosa-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 88761657 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | (2,4,6-trimethylphenyl) (2E,4Z,6E,8Z,10Z)-icosa-2,4,6,8,10-pentaenoate |
| SMILES | CCCCCCCCC/C=C\C=C/C=C/C=C\C=C\C(=O)Oc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C29H40O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-28(30)31-29-26(3)23-25(2)24-27(29)4/h13-24H,5-12H2,1-4H3/b14-13-,16-15-,18-17+,20-19-,22-21+ |
| InChIKey | LBWCGARJTXIFEL-OXLILDHXSA-N |
| XLogP | 8.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|