C23H36O2 — CID 74223057
ethyl (2E,4E,6E,8E,10E)-henicosa-2,4,6,8,10-pentaenoate (PubChem CID 74223057) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E,10E)-henicosa-2,4,6,8,10-pentaenoate.
| Compound Name | ethyl (2E,4E,6E,8E,10E)-henicosa-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 74223057 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | ethyl (2E,4E,6E,8E,10E)-henicosa-2,4,6,8,10-pentaenoate |
| SMILES | CCCCCCCCCC/C=C/C=C/C=C/C=C/C=C/C(=O)OCC |
| InChI | InChI=1S/C23H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25-4-2/h13-22H,3-12H2,1-2H3/b14-13+,16-15+,18-17+,20-19+,22-21+ |
| InChIKey | FEDXWGXJVSAPGM-HTXRNKDDSA-N |
| XLogP | 6.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|