C24H40O4 — CID 87304480
ethyl deca-2,4-dienoate;ethyl (2E,4Z)-deca-2,4-dienoate (PubChem CID 87304480) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is ethyl deca-2,4-dienoate;ethyl (2E,4Z)-deca-2,4-dienoate.
| Compound Name | ethyl deca-2,4-dienoate;ethyl (2E,4Z)-deca-2,4-dienoate |
|---|---|
| PubChem CID | 87304480 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | ethyl deca-2,4-dienoate;ethyl (2E,4Z)-deca-2,4-dienoate |
| SMILES | CCCCC/C=C\C=C\C(=O)OCC.CCCCCC=CC=CC(=O)OCC |
| InChI | InChI=1S/2C12H20O2/c2*1-3-5-6-7-8-9-10-11-12(13)14-4-2/h2*8-11H,3-7H2,1-2H3/b9-8-,11-10+; |
| InChIKey | HYYZQVMFHATFSH-DMFNYBFFSA-N |
| XLogP | 6.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|