C26H40O2 — CID 139917793
2-methylpropyl docosa-2,4,6,8,10,12-hexaenoate (PubChem CID 139917793) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 2-methylpropyl docosa-2,4,6,8,10,12-hexaenoate.
| Compound Name | 2-methylpropyl docosa-2,4,6,8,10,12-hexaenoate |
|---|---|
| PubChem CID | 139917793 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 2-methylpropyl docosa-2,4,6,8,10,12-hexaenoate |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)OCC(C)C |
| InChI | InChI=1S/C26H40O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-26(27)28-24-25(2)3/h12-23,25H,4-11,24H2,1-3H3 |
| InChIKey | CQARMNKERQKYPZ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|