C24H33Cl3O2 — CID 14747462
(2,4,6-trichlorophenyl) (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 14747462) has the molecular formula C24H33Cl3O2 and a molecular weight of 459.89 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | (2,4,6-trichlorophenyl) (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 14747462 |
| Molecular Formula | C24H33Cl3O2 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (2,4,6-trichlorophenyl) (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C24H33Cl3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(28)29-24-21(26)18-20(25)19-22(24)27/h6-7,9-10,18-19H,2-5,8,11-17H2,1H3/b7-6-,10-9- |
| InChIKey | GAUKGRVSMVSFFH-HZJYTTRNSA-N |
| XLogP | 9.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|