C13H17NO3S — CID 162402165
ethyl (2E)-2-[(R)-(2,4,6-trimethylphenyl)sulfinyl]iminoacetate (PubChem CID 162402165) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is ethyl (2E)-2-[(R)-(2,4,6-trimethylphenyl)sulfinyl]iminoacetate.
| Compound Name | ethyl (2E)-2-[(R)-(2,4,6-trimethylphenyl)sulfinyl]iminoacetate |
|---|---|
| PubChem CID | 162402165 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | ethyl (2E)-2-[(R)-(2,4,6-trimethylphenyl)sulfinyl]iminoacetate |
| SMILES | CCOC(=O)/C=N/[S@](=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C13H17NO3S/c1-5-17-12(15)8-14-18(16)13-10(3)6-9(2)7-11(13)4/h6-8H,5H2,1-4H3/b14-8+/t18-/m1/s1 |
| InChIKey | OUMNTVUUJPMNPJ-ODHXBGJQSA-N |
| XLogP | 2.27 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|