C16H21LiO3 — CID 134973705
lithium ethyl 3-[(1R)-1-(2,4,6-trimethylphenyl)ethoxy]prop-2-enoate (PubChem CID 134973705) has the molecular formula C16H21LiO3 and a molecular weight of 268.28 g/mol. Its IUPAC name is lithium ethyl 3-[(1R)-1-(2,4,6-trimethylphenyl)ethoxy]prop-2-enoate.
| Compound Name | lithium ethyl 3-[(1R)-1-(2,4,6-trimethylphenyl)ethoxy]prop-2-enoate |
|---|---|
| PubChem CID | 134973705 |
| Molecular Formula | C16H21LiO3 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | lithium ethyl 3-[(1R)-1-(2,4,6-trimethylphenyl)ethoxy]prop-2-enoate |
| SMILES | CCOC(=O)/C=[C-]/O[C@H](C)c1c(C)cc(C)cc1C.[Li+] |
| InChI | InChI=1S/C16H21O3.Li/c1-6-18-15(17)7-8-19-14(5)16-12(3)9-11(2)10-13(16)4;/h7,9-10,14H,6H2,1-5H3;/q-1;+1/t14-;/m1./s1 |
| InChIKey | AFMCZIKVSVMXNK-PFEQFJNWSA-N |
| XLogP | 0.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|