C17H27O3P — CID 71606180
2-[(E)-4-diethoxyphosphorylbut-3-en-2-yl]-1,3,5-trimethylbenzene (PubChem CID 71606180) has the molecular formula C17H27O3P and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-[(E)-4-diethoxyphosphorylbut-3-en-2-yl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[(E)-4-diethoxyphosphorylbut-3-en-2-yl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 71606180 |
| Molecular Formula | C17H27O3P |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-[(E)-4-diethoxyphosphorylbut-3-en-2-yl]-1,3,5-trimethylbenzene |
| SMILES | CCOP(=O)(/C=C/C(C)c1c(C)cc(C)cc1C)OCC |
| InChI | InChI=1S/C17H27O3P/c1-7-19-21(18,20-8-2)10-9-14(4)17-15(5)11-13(3)12-16(17)6/h9-12,14H,7-8H2,1-6H3/b10-9+ |
| InChIKey | DUTRBBRMAAIORG-MDZDMXLPSA-N |
| XLogP | 5.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|