About ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate
ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate (PubChem CID 57051931) has the molecular formula C20H28O3
and a molecular weight of 316.44 g/mol. Its IUPAC name is ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate |
| PubChem CID | 57051931 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(C(=O)C(C)c2c(C)cc(C)cc2C)C1 |
| InChI | InChI=1S/C20H28O3/c1-6-23-20(22)17-8-7-16(11-17)19(21)15(5)18-13(3)9-12(2)10-14(18)4/h9-10,15-17H,6-8,11H2,1-5H3 |
| InChIKey | XUVFORIJVAFWIM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate?
The IUPAC name of ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate (CID 57051931) is ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate.
What is the SMILES notation for ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate?
The canonical SMILES for ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate is CCOC(=O)C1CCC(C(=O)C(C)c2c(C)cc(C)cc2C)C1.
What is the InChIKey of ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate?
The InChIKey is XUVFORIJVAFWIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O3/c1-6-23-20(22)17-8-7-16(11-17)19(21)15(5)18-13(3)9-12(2)10-14(18)4/h9-10,15-17H,6-8,11H2,1-5H3.
What are the key properties of ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate?
ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate has a molecular weight of 316.44 g/mol, XLogP of 4.26, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-(2,4,6-trimethylphenyl)propanoyl]cyclopentane-1-carboxylate is sourced from PubChem (CID 57051931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).