C10H18O3 — CID 125113083
trans-ethyl (1S,3S)-3-ethoxycyclopentane-1-carboxylate (PubChem CID 125113083) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is trans-ethyl (1S,3S)-3-ethoxycyclopentane-1-carboxylate.
| Compound Name | trans-ethyl (1S,3S)-3-ethoxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 125113083 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | trans-ethyl (1S,3S)-3-ethoxycyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@H](OCC)C1 |
| InChI | InChI=1S/C10H18O3/c1-3-12-9-6-5-8(7-9)10(11)13-4-2/h8-9H,3-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | XIJHEQLOKRESAA-IUCAKERBSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |