C9H14O3 — CID 57416186
ethyl (1S,3S,6R)-7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 57416186) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is ethyl (1S,3S,6R)-7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | ethyl (1S,3S,6R)-7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 57416186 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | ethyl (1S,3S,6R)-7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@H]2O[C@H]2C1 |
| InChI | InChI=1S/C9H14O3/c1-2-11-9(10)6-3-4-7-8(5-6)12-7/h6-8H,2-5H2,1H3/t6-,7+,8-/m0/s1 |
| InChIKey | ALEAMASTTOYSRW-RNJXMRFFSA-N |
| XLogP | 1.12 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|