C7H11NO3 — CID 152950134
amino 7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 152950134) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is amino 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | amino 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 152950134 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | amino 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | NOC(=O)C1CCC2OC2C1 |
| InChI | InChI=1S/C7H11NO3/c8-11-7(9)4-1-2-5-6(3-4)10-5/h4-6H,1-3,8H2 |
| InChIKey | AWTWMDORWICASI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|