C16H24O6 — CID 174903324
ethyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid (PubChem CID 174903324) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is ethyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid.
| Compound Name | ethyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 174903324 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | ethyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid |
| SMILES | CCOC(=O)C1CCC2OC2C1.O=C(O)C1CCC2OC2C1 |
| InChI | InChI=1S/C9H14O3.C7H10O3/c1-2-11-9(10)6-3-4-7-8(5-6)12-7;8-7(9)4-1-2-5-6(3-4)10-5/h6-8H,2-5H2,1H3;4-6H,1-3H2,(H,8,9) |
| InChIKey | JNJHSNIPKVWMOT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|