C11H18O4 — CID 149054269
4-hydroxybutyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 149054269) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 4-hydroxybutyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | 4-hydroxybutyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 149054269 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 4-hydroxybutyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | O=C(OCCCCO)C1CCC2OC2C1 |
| InChI | InChI=1S/C11H18O4/c12-5-1-2-6-14-11(13)8-3-4-9-10(7-8)15-9/h8-10,12H,1-7H2 |
| InChIKey | QKKQPFABVKVTTD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|