C9H16FNO2 — CID 172915911
ethyl (1S,3R,4S)-4-amino-3-fluorocyclohexane-1-carboxylate (PubChem CID 172915911) has the molecular formula C9H16FNO2 and a molecular weight of 189.23 g/mol. Its IUPAC name is ethyl (1S,3R,4S)-4-amino-3-fluorocyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,3R,4S)-4-amino-3-fluorocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 172915911 |
| Molecular Formula | C9H16FNO2 |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | ethyl (1S,3R,4S)-4-amino-3-fluorocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@H](N)[C@H](F)C1 |
| InChI | InChI=1S/C9H16FNO2/c1-2-13-9(12)6-3-4-8(11)7(10)5-6/h6-8H,2-5,11H2,1H3/t6-,7+,8-/m0/s1 |
| InChIKey | DJULMJIOMZUUTF-RNJXMRFFSA-N |
| XLogP | 1.01 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |