C8H12F2O2 — CID 155893125
ethyl 3,4-difluorocyclopentane-1-carboxylate (PubChem CID 155893125) has the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. Its IUPAC name is ethyl 3,4-difluorocyclopentane-1-carboxylate.
| Compound Name | ethyl 3,4-difluorocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 155893125 |
| Molecular Formula | C8H12F2O2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | ethyl 3,4-difluorocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(F)C(F)C1 |
| InChI | InChI=1S/C8H12F2O2/c1-2-12-8(11)5-3-6(9)7(10)4-5/h5-7H,2-4H2,1H3 |
| InChIKey | IUNGYIKEKVKPOM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |