About ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride
ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride (PubChem CID 159150821) has the molecular formula C9H15ClO2
and a molecular weight of 190.67 g/mol. Its IUPAC name is ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride.
Analyze ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride?
The IUPAC name of ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride (CID 159150821) is ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride.
What is the SMILES notation for ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride?
The canonical SMILES for ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride is CCOC(=O)C1C[C@@H]2C[C@@H]2C1.Cl.
What is the InChIKey of ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride?
The InChIKey is QMZCLMXELHNEPN-PAFGHYSMSA-N. The full InChI is InChI=1S/C9H14O2.ClH/c1-2-11-9(10)8-4-6-3-7(6)5-8;/h6-8H,2-5H2,1H3;1H/t6-,7+,8?;.
What are the key properties of ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride?
ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride has a molecular weight of 190.67 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (1S,5R)-bicyclo[3.1.0]hexane-3-carboxylate;hydrochloride is sourced from PubChem (CID 159150821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).