C11H19NO4 — CID 66523120
diethyl (3S,5R)-piperidine-3,5-dicarboxylate (PubChem CID 66523120) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is diethyl (3S,5R)-piperidine-3,5-dicarboxylate.
| Compound Name | diethyl (3S,5R)-piperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 66523120 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | diethyl (3S,5R)-piperidine-3,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CNC[C@H](C(=O)OCC)C1 |
| InChI | InChI=1S/C11H19NO4/c1-3-15-10(13)8-5-9(7-12-6-8)11(14)16-4-2/h8-9,12H,3-7H2,1-2H3/t8-,9+ |
| InChIKey | BZFYHGMPBYRDSW-DTORHVGOSA-N |
| XLogP | 0.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |