C8H16N2O4S — CID 134552702
ethyl (3R,5S)-5-sulfamoylpiperidine-3-carboxylate (PubChem CID 134552702) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is ethyl (3R,5S)-5-sulfamoylpiperidine-3-carboxylate.
| Compound Name | ethyl (3R,5S)-5-sulfamoylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 134552702 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | ethyl (3R,5S)-5-sulfamoylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CNC[C@@H](S(N)(=O)=O)C1 |
| InChI | InChI=1S/C8H16N2O4S/c1-2-14-8(11)6-3-7(5-10-4-6)15(9,12)13/h6-7,10H,2-5H2,1H3,(H2,9,12,13)/t6-,7+/m1/s1 |
| InChIKey | ALQVVAGFVDXXMR-RQJHMYQMSA-N |
| XLogP | -1.18 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |