C9H15NO4 — CID 69137212
dimethyl (3R,5R)-piperidine-3,5-dicarboxylate (PubChem CID 69137212) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is dimethyl (3R,5R)-piperidine-3,5-dicarboxylate.
| Compound Name | dimethyl (3R,5R)-piperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 69137212 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | dimethyl (3R,5R)-piperidine-3,5-dicarboxylate |
| SMILES | COC(=O)[C@H]1CNC[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C9H15NO4/c1-13-8(11)6-3-7(5-10-4-6)9(12)14-2/h6-7,10H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | FOEXRJBHOCBGFH-RNFRBKRXSA-N |
| XLogP | -0.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |