C9H14O4 — CID 642990
cis-dimethyl (1R,3S)-cyclopentane-1,3-dicarboxylate (PubChem CID 642990) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is cis-dimethyl (1R,3S)-cyclopentane-1,3-dicarboxylate.
| Compound Name | cis-dimethyl (1R,3S)-cyclopentane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 642990 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | cis-dimethyl (1R,3S)-cyclopentane-1,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C9H14O4/c1-12-8(10)6-3-4-7(5-6)9(11)13-2/h6-7H,3-5H2,1-2H3/t6-,7+ |
| InChIKey | SQFQEQDRLAZVJQ-KNVOCYPGSA-N |
| XLogP | 0.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |