About cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate
cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate (PubChem CID 90378778) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate.
Analyze cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate?
The IUPAC name of cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate (CID 90378778) is cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate.
What is the SMILES notation for cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate?
The canonical SMILES for cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate is CN[C@@H]1CC[C@H](C(=O)OC)C1.
What is the InChIKey of cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate?
The InChIKey is FYKQCEKTPDPCIP-NKWVEPMBSA-N. The full InChI is InChI=1S/C8H15NO2/c1-9-7-4-3-6(5-7)8(10)11-2/h6-7,9H,3-5H2,1-2H3/t6-,7+/m0/s1.
What are the key properties of cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate?
cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate has a molecular weight of 157.21 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1S,3R)-3-(methylamino)cyclopentane-1-carboxylate is sourced from PubChem (CID 90378778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).