C9H16O2 — CID 129368474
cis-methyl (1R,3S)-3-ethylcyclopentane-1-carboxylate (PubChem CID 129368474) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is cis-methyl (1R,3S)-3-ethylcyclopentane-1-carboxylate.
| Compound Name | cis-methyl (1R,3S)-3-ethylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 129368474 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | cis-methyl (1R,3S)-3-ethylcyclopentane-1-carboxylate |
| SMILES | CC[C@H]1CC[C@@H](C(=O)OC)C1 |
| InChI | InChI=1S/C9H16O2/c1-3-7-4-5-8(6-7)9(10)11-2/h7-8H,3-6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | OPPQXFJWBOHJKL-JGVFFNPUSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |