C9H15NO3 — CID 89096292
methyl 4-formamidocyclohexane-1-carboxylate (PubChem CID 89096292) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is methyl 4-formamidocyclohexane-1-carboxylate.
| Compound Name | methyl 4-formamidocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 89096292 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | methyl 4-formamidocyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC=O)CC1 |
| InChI | InChI=1S/C9H15NO3/c1-13-9(12)7-2-4-8(5-3-7)10-6-11/h6-8H,2-5H2,1H3,(H,10,11) |
| InChIKey | HGAZTTFOLNJFNW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|