C9H16O6S — CID 140602376
methyl 4-[[dihydroxy(oxo)-λ6-sulfanylidene]-hydroxymethyl]cyclohexane-1-carboxylate (PubChem CID 140602376) has the molecular formula C9H16O6S and a molecular weight of 252.29 g/mol. Its IUPAC name is methyl 4-[[dihydroxy(oxo)-λ6-sulfanylidene]-hydroxymethyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[dihydroxy(oxo)-λ6-sulfanylidene]-hydroxymethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 140602376 |
| Molecular Formula | C9H16O6S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | methyl 4-[[dihydroxy(oxo)-λ6-sulfanylidene]-hydroxymethyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(C(O)=S(=O)(O)O)CC1 |
| InChI | InChI=1S/C9H16O6S/c1-15-8(10)6-2-4-7(5-3-6)9(11)16(12,13)14/h6-7,11H,2-5H2,1H3,(H2,12,13,14) |
| InChIKey | IBWDAUVYCQUUTO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|