C9H15F2NO4S — CID 112690078
methyl 4-(difluoromethylsulfonylamino)cyclohexane-1-carboxylate (PubChem CID 112690078) has the molecular formula C9H15F2NO4S and a molecular weight of 271.28 g/mol. Its IUPAC name is methyl 4-(difluoromethylsulfonylamino)cyclohexane-1-carboxylate.
| Compound Name | methyl 4-(difluoromethylsulfonylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 112690078 |
| Molecular Formula | C9H15F2NO4S |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | methyl 4-(difluoromethylsulfonylamino)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NS(=O)(=O)C(F)F)CC1 |
| InChI | InChI=1S/C9H15F2NO4S/c1-16-8(13)6-2-4-7(5-3-6)12-17(14,15)9(10)11/h6-7,9,12H,2-5H2,1H3 |
| InChIKey | IZZREAWNLXXBBU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |