C10H17N3O4 — CID 70075440
methyl 4-(formamidocarbamoylamino)cyclohexane-1-carboxylate (PubChem CID 70075440) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is methyl 4-(formamidocarbamoylamino)cyclohexane-1-carboxylate.
| Compound Name | methyl 4-(formamidocarbamoylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70075440 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | methyl 4-(formamidocarbamoylamino)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)NNC=O)CC1 |
| InChI | InChI=1S/C10H17N3O4/c1-17-9(15)7-2-4-8(5-3-7)12-10(16)13-11-6-14/h6-8H,2-5H2,1H3,(H,11,14)(H2,12,13,16) |
| InChIKey | ZJQBUUSITSQJBX-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|