C18H32N6O6 — CID 144980905
methyl N-[4-[[[4-(methoxycarbonylamino)cyclohexyl]carbamoylamino]carbamoylamino]cyclohexyl]carbamate (PubChem CID 144980905) has the molecular formula C18H32N6O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is methyl N-[4-[[[4-(methoxycarbonylamino)cyclohexyl]carbamoylamino]carbamoylamino]cyclohexyl]carbamate.
| Compound Name | methyl N-[4-[[[4-(methoxycarbonylamino)cyclohexyl]carbamoylamino]carbamoylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 144980905 |
| Molecular Formula | C18H32N6O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | methyl N-[4-[[[4-(methoxycarbonylamino)cyclohexyl]carbamoylamino]carbamoylamino]cyclohexyl]carbamate |
| SMILES | COC(=O)NC1CCC(NC(=O)NNC(=O)NC2CCC(NC(=O)OC)CC2)CC1 |
| InChI | InChI=1S/C18H32N6O6/c1-29-17(27)21-13-7-3-11(4-8-13)19-15(25)23-24-16(26)20-12-5-9-14(10-6-12)22-18(28)30-2/h11-14H,3-10H2,1-2H3,(H,21,27)(H,22,28)(H2,19,23,25)(H2,20,24,26) |
| InChIKey | IXCLBFZTHGXFBO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 158.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|