C9H17NO4 — CID 20642197
methyl N-[4-(hydroperoxymethyl)cyclohexyl]carbamate (PubChem CID 20642197) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is methyl N-[4-(hydroperoxymethyl)cyclohexyl]carbamate.
| Compound Name | methyl N-[4-(hydroperoxymethyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 20642197 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | methyl N-[4-(hydroperoxymethyl)cyclohexyl]carbamate |
| SMILES | COC(=O)NC1CCC(COO)CC1 |
| InChI | InChI=1S/C9H17NO4/c1-13-9(11)10-8-4-2-7(3-5-8)6-14-12/h7-8,12H,2-6H2,1H3,(H,10,11) |
| InChIKey | VLCQFBBIJKGIMD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|