C15H28N2O4 — CID 176736316
[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl N-ethylcarbamate (PubChem CID 176736316) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is [4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl N-ethylcarbamate.
| Compound Name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 176736316 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H28N2O4/c1-5-16-13(18)20-10-11-6-8-12(9-7-11)17-14(19)21-15(2,3)4/h11-12H,5-10H2,1-4H3,(H,16,18)(H,17,19) |
| InChIKey | PKAQRCIQVIFJDW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |