C22H43NO6 — CID 170442416
tert-butyl N-[4-[2-[2-(2-butoxyethoxy)ethoxy]ethoxymethyl]cyclohexyl]carbamate (PubChem CID 170442416) has the molecular formula C22H43NO6 and a molecular weight of 417.59 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[2-(2-butoxyethoxy)ethoxy]ethoxymethyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[2-(2-butoxyethoxy)ethoxy]ethoxymethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 170442416 |
| Molecular Formula | C22H43NO6 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | tert-butyl N-[4-[2-[2-(2-butoxyethoxy)ethoxy]ethoxymethyl]cyclohexyl]carbamate |
| SMILES | CCCCOCCOCCOCCOCC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H43NO6/c1-5-6-11-25-12-13-26-14-15-27-16-17-28-18-19-7-9-20(10-8-19)23-21(24)29-22(2,3)4/h19-20H,5-18H2,1-4H3,(H,23,24) |
| InChIKey | UNJQGAQJBDBKDE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|