C32H64N4O6S2 — CID 159288412
tert-butyl N-[4-[(tert-butylsulfinylamino)methyl]cyclohexyl]carbamate (PubChem CID 159288412) has the molecular formula C32H64N4O6S2 and a molecular weight of 665.02 g/mol. Its IUPAC name is tert-butyl N-[4-[(tert-butylsulfinylamino)methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(tert-butylsulfinylamino)methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 159288412 |
| Molecular Formula | C32H64N4O6S2 |
| Molecular Weight | 665.02 g/mol |
| Exact Mass | 664.43 |
| IUPAC Name | tert-butyl N-[4-[(tert-butylsulfinylamino)methyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CNS(=O)C(C)(C)C)CC1.CC(C)(C)OC(=O)NC1CCC(CNS(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/2C16H32N2O3S/c2*1-15(2,3)21-14(19)18-13-9-7-12(8-10-13)11-17-22(20)16(4,5)6/h2*12-13,17H,7-11H2,1-6H3,(H,18,19) |
| InChIKey | KZUMFMLJLQMEKI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.02 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |