C18H36N2O7 — CID 138695815
[4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]cyclohexyl]carbamic acid (PubChem CID 138695815) has the molecular formula C18H36N2O7 and a molecular weight of 392.49 g/mol. Its IUPAC name is [4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]cyclohexyl]carbamic acid.
| Compound Name | [4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 138695815 |
| Molecular Formula | C18H36N2O7 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | [4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]cyclohexyl]carbamic acid |
| SMILES | NCCOCCOCCOCCOCCOCC1CCC(NC(=O)O)CC1 |
| InChI | InChI=1S/C18H36N2O7/c19-5-6-23-7-8-24-9-10-25-11-12-26-13-14-27-15-16-1-3-17(4-2-16)20-18(21)22/h16-17,20H,1-15,19H2,(H,21,22) |
| InChIKey | ORDLKWYECMBWBJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|