C13H25NO6 — CID 138694512
[(1R,3R)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxymethyl]cyclopentyl]carbamic acid (PubChem CID 138694512) has the molecular formula C13H25NO6 and a molecular weight of 291.34 g/mol. Its IUPAC name is [(1R,3R)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxymethyl]cyclopentyl]carbamic acid.
| Compound Name | [(1R,3R)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxymethyl]cyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 138694512 |
| Molecular Formula | C13H25NO6 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | [(1R,3R)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxymethyl]cyclopentyl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CC[C@@H](COCCOCCOCCO)C1 |
| InChI | InChI=1S/C13H25NO6/c15-3-4-18-5-6-19-7-8-20-10-11-1-2-12(9-11)14-13(16)17/h11-12,14-15H,1-10H2,(H,16,17)/t11-,12-/m1/s1 |
| InChIKey | ODCDJQMZHTYFBL-VXGBXAGGSA-N |
| XLogP | 0.46 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|