C12H23NO6 — CID 138694811
[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxymethyl]cyclobutyl]carbamic acid (PubChem CID 138694811) has the molecular formula C12H23NO6 and a molecular weight of 277.32 g/mol. Its IUPAC name is [3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxymethyl]cyclobutyl]carbamic acid.
| Compound Name | [3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxymethyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 138694811 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | [3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxymethyl]cyclobutyl]carbamic acid |
| SMILES | O=C(O)NC1CC(COCCOCCOCCO)C1 |
| InChI | InChI=1S/C12H23NO6/c14-1-2-17-3-4-18-5-6-19-9-10-7-11(8-10)13-12(15)16/h10-11,13-14H,1-9H2,(H,15,16) |
| InChIKey | HNFUELUHUNGRQY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|