C16H31NO8 — CID 138695751
[3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]cyclobutyl] carbamate (PubChem CID 138695751) has the molecular formula C16H31NO8 and a molecular weight of 365.42 g/mol. Its IUPAC name is [3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]cyclobutyl] carbamate.
| Compound Name | [3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]cyclobutyl] carbamate |
|---|---|
| PubChem CID | 138695751 |
| Molecular Formula | C16H31NO8 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]cyclobutyl] carbamate |
| SMILES | NC(=O)OC1CC(COCCOCCOCCOCCOCCO)C1 |
| InChI | InChI=1S/C16H31NO8/c17-16(19)25-15-11-14(12-15)13-24-10-9-23-8-7-22-6-5-21-4-3-20-2-1-18/h14-15,18H,1-13H2,(H2,17,19) |
| InChIKey | QTLUXKCAXMDYEB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|