[(1S,3R)-3-aminocyclopentyl]carbamic acid

C6H12N2O2 — CID 67513100

IUPAC[(1S,3R)-3-aminocyclopentyl]carbamic acid
SMILESN[C@@H]1CC[C@H](NC(=O)O)C1
InChIInChI=1S/C6H12N2O2/c7-4-1-2-5(3-4)8-6(9)10/h4-5,8H,1-3,7H2,(H,9,10)/t4-,5+/m1/s1
InChIKeyFNLOCWGCZOBFND-UHNVWZDZSA-N
MW144.17 g/mol
LogP0.13
Rot. Bonds1

About [(1S,3R)-3-aminocyclopentyl]carbamic acid

[(1S,3R)-3-aminocyclopentyl]carbamic acid (PubChem CID 67513100) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is [(1S,3R)-3-aminocyclopentyl]carbamic acid.

Molecular Properties

Compound Name[(1S,3R)-3-aminocyclopentyl]carbamic acid
PubChem CID67513100
Molecular FormulaC6H12N2O2
Molecular Weight144.17 g/mol
Exact Mass144.09
IUPAC Name[(1S,3R)-3-aminocyclopentyl]carbamic acid
SMILESN[C@@H]1CC[C@H](NC(=O)O)C1
InChIInChI=1S/C6H12N2O2/c7-4-1-2-5(3-4)8-6(9)10/h4-5,8H,1-3,7H2,(H,9,10)/t4-,5+/m1/s1
InChIKeyFNLOCWGCZOBFND-UHNVWZDZSA-N
XLogP0.13
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.17
LogP ≤ 50.13
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze [(1S,3R)-3-aminocyclopentyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1S,3R)-3-aminocyclopentyl]carbamic acid?
The IUPAC name of [(1S,3R)-3-aminocyclopentyl]carbamic acid (CID 67513100) is [(1S,3R)-3-aminocyclopentyl]carbamic acid.
What is the SMILES notation for [(1S,3R)-3-aminocyclopentyl]carbamic acid?
The canonical SMILES for [(1S,3R)-3-aminocyclopentyl]carbamic acid is N[C@@H]1CC[C@H](NC(=O)O)C1.
What is the InChIKey of [(1S,3R)-3-aminocyclopentyl]carbamic acid?
The InChIKey is FNLOCWGCZOBFND-UHNVWZDZSA-N. The full InChI is InChI=1S/C6H12N2O2/c7-4-1-2-5(3-4)8-6(9)10/h4-5,8H,1-3,7H2,(H,9,10)/t4-,5+/m1/s1.
What are the key properties of [(1S,3R)-3-aminocyclopentyl]carbamic acid?
[(1S,3R)-3-aminocyclopentyl]carbamic acid has a molecular weight of 144.17 g/mol, XLogP of 0.13, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3R)-3-aminocyclopentyl]carbamic acid is sourced from PubChem (CID 67513100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).