C6H12N2O2 — CID 67513100
[(1S,3R)-3-aminocyclopentyl]carbamic acid (PubChem CID 67513100) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is [(1S,3R)-3-aminocyclopentyl]carbamic acid.
| Compound Name | [(1S,3R)-3-aminocyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 67513100 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | [(1S,3R)-3-aminocyclopentyl]carbamic acid |
| SMILES | N[C@@H]1CC[C@H](NC(=O)O)C1 |
| InChI | InChI=1S/C6H12N2O2/c7-4-1-2-5(3-4)8-6(9)10/h4-5,8H,1-3,7H2,(H,9,10)/t4-,5+/m1/s1 |
| InChIKey | FNLOCWGCZOBFND-UHNVWZDZSA-N |
| XLogP | 0.13 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |