C9H16N2OS — CID 176678235
(Z)-N-[(1S,3R)-3-aminocyclopentyl]-2-sulfanylbut-2-enamide (PubChem CID 176678235) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is (Z)-N-[(1S,3R)-3-aminocyclopentyl]-2-sulfanylbut-2-enamide.
| Compound Name | (Z)-N-[(1S,3R)-3-aminocyclopentyl]-2-sulfanylbut-2-enamide |
|---|---|
| PubChem CID | 176678235 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (Z)-N-[(1S,3R)-3-aminocyclopentyl]-2-sulfanylbut-2-enamide |
| SMILES | C/C=C(\S)C(=O)N[C@H]1CC[C@@H](N)C1 |
| InChI | InChI=1S/C9H16N2OS/c1-2-8(13)9(12)11-7-4-3-6(10)5-7/h2,6-7,13H,3-5,10H2,1H3,(H,11,12)/b8-2-/t6-,7+/m1/s1 |
| InChIKey | OJICRDLRPWNTAV-VKFSICQESA-N |
| XLogP | 0.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|