C7H14N2O3 — CID 130303554
[(1R,3R,4R)-4-amino-3-hydroxycyclohexyl]carbamic acid (PubChem CID 130303554) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is [(1R,3R,4R)-4-amino-3-hydroxycyclohexyl]carbamic acid.
| Compound Name | [(1R,3R,4R)-4-amino-3-hydroxycyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 130303554 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | [(1R,3R,4R)-4-amino-3-hydroxycyclohexyl]carbamic acid |
| SMILES | N[C@@H]1CC[C@@H](NC(=O)O)C[C@H]1O |
| InChI | InChI=1S/C7H14N2O3/c8-5-2-1-4(3-6(5)10)9-7(11)12/h4-6,9-10H,1-3,8H2,(H,11,12)/t4-,5-,6-/m1/s1 |
| InChIKey | HBMALUPTNZSWHQ-HSUXUTPPSA-N |
| XLogP | -0.51 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |