[(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid

C7H14N2O2 — CID 146636382

IUPAC[(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid
SMILESCN[C@@H]1CC[C@H](NC(=O)O)C1
InChIInChI=1S/C7H14N2O2/c1-8-5-2-3-6(4-5)9-7(10)11/h5-6,8-9H,2-4H2,1H3,(H,10,11)/t5-,6+/m1/s1
InChIKeyUFCFMPGDFRLPSZ-RITPCOANSA-N
MW158.20 g/mol
LogP0.39
Rot. Bonds2

About [(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid

[(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid (PubChem CID 146636382) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is [(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid.

Molecular Properties

Compound Name[(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid
PubChem CID146636382
Molecular FormulaC7H14N2O2
Molecular Weight158.20 g/mol
Exact Mass158.11
IUPAC Name[(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid
SMILESCN[C@@H]1CC[C@H](NC(=O)O)C1
InChIInChI=1S/C7H14N2O2/c1-8-5-2-3-6(4-5)9-7(10)11/h5-6,8-9H,2-4H2,1H3,(H,10,11)/t5-,6+/m1/s1
InChIKeyUFCFMPGDFRLPSZ-RITPCOANSA-N
XLogP0.39
TPSA61.36 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.20
LogP ≤ 50.39
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze [(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

[3-(methylamino)cyclobutyl]carbamic acid
CID 90355719
N-[(1R,3S)-3-(methylamino)cyclopentyl]acetamide
CID 139574017
[(1S,3R)-3-aminocyclopentyl]carbamic acid
CID 67513100
(3-aminocyclopentyl)carbamic acid
CID 69243227
[(3R)-3-aminocyclopentyl]carbamic acid
CID 68775558
[(1S,3S)-3-methoxycyclopentyl]carbamic acid
CID 135318660
[(1R,3S,4S)-3-hydroxy-4-methylcyclohexyl]carbamic acid
CID 89396263
(3-hydroxy-4-methylcyclohexyl)carbamic acid
CID 89157990
[(1S,2S,5S)-5-(carboxyamino)-2-methoxycyclohexyl]carbamic acid
CID 146636200
(3-methylcycloheptyl)carbamic acid
CID 143291001
(3-methylcyclohexyl)carbamic acid
CID 67410451
[(1R,3R)-3-(hydroxymethyl)cyclopentyl]carbamic acid
CID 174154998

Frequently Asked Questions

What is the IUPAC name of [(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid?
The IUPAC name of [(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid (CID 146636382) is [(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid.
What is the SMILES notation for [(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid?
The canonical SMILES for [(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid is CN[C@@H]1CC[C@H](NC(=O)O)C1.
What is the InChIKey of [(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid?
The InChIKey is UFCFMPGDFRLPSZ-RITPCOANSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-8-5-2-3-6(4-5)9-7(10)11/h5-6,8-9H,2-4H2,1H3,(H,10,11)/t5-,6+/m1/s1.
What are the key properties of [(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid?
[(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid has a molecular weight of 158.20 g/mol, XLogP of 0.39, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3R)-3-(methylamino)cyclopentyl]carbamic acid is sourced from PubChem (CID 146636382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).