C8H16N2O — CID 139574017
N-[(1R,3S)-3-(methylamino)cyclopentyl]acetamide (PubChem CID 139574017) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is N-[(1R,3S)-3-(methylamino)cyclopentyl]acetamide.
| Compound Name | N-[(1R,3S)-3-(methylamino)cyclopentyl]acetamide |
|---|---|
| PubChem CID | 139574017 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | N-[(1R,3S)-3-(methylamino)cyclopentyl]acetamide |
| SMILES | CN[C@H]1CC[C@@H](NC(C)=O)C1 |
| InChI | InChI=1S/C8H16N2O/c1-6(11)10-8-4-3-7(5-8)9-2/h7-9H,3-5H2,1-2H3,(H,10,11)/t7-,8+/m0/s1 |
| InChIKey | HYDQKRJLDVQRPO-JGVFFNPUSA-N |
| XLogP | 0.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |