C11H22N2O — CID 139573847
N-[(1R,3S)-3-(tert-butylamino)cyclopentyl]acetamide (PubChem CID 139573847) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is N-[(1R,3S)-3-(tert-butylamino)cyclopentyl]acetamide.
| Compound Name | N-[(1R,3S)-3-(tert-butylamino)cyclopentyl]acetamide |
|---|---|
| PubChem CID | 139573847 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | N-[(1R,3S)-3-(tert-butylamino)cyclopentyl]acetamide |
| SMILES | CC(=O)N[C@@H]1CC[C@H](NC(C)(C)C)C1 |
| InChI | InChI=1S/C11H22N2O/c1-8(14)12-9-5-6-10(7-9)13-11(2,3)4/h9-10,13H,5-7H2,1-4H3,(H,12,14)/t9-,10+/m1/s1 |
| InChIKey | YHJVWGOVAOXJSF-ZJUUUORDSA-N |
| XLogP | 1.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |