C15H30N2O2 — CID 58003870
3,5-bis(tert-butylamino)cyclohexane-1-carboxylic acid (PubChem CID 58003870) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 3,5-bis(tert-butylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 3,5-bis(tert-butylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 58003870 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 3,5-bis(tert-butylamino)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)NC1CC(NC(C)(C)C)CC(C(=O)O)C1 |
| InChI | InChI=1S/C15H30N2O2/c1-14(2,3)16-11-7-10(13(18)19)8-12(9-11)17-15(4,5)6/h10-12,16-17H,7-9H2,1-6H3,(H,18,19) |
| InChIKey | APSAZWHGTDKGPG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |