C11H16O6 — CID 23444132
3,5-bis(methoxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 23444132) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is 3,5-bis(methoxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 3,5-bis(methoxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 23444132 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 3,5-bis(methoxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | COC(=O)C1CC(C(=O)O)CC(C(=O)OC)C1 |
| InChI | InChI=1S/C11H16O6/c1-16-10(14)7-3-6(9(12)13)4-8(5-7)11(15)17-2/h6-8H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | PZFDNDQDHXLHPE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |