C12H18O5 — CID 135297796
dimethyl (3R)-5-acetylcyclohexane-1,3-dicarboxylate (PubChem CID 135297796) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is dimethyl (3R)-5-acetylcyclohexane-1,3-dicarboxylate.
| Compound Name | dimethyl (3R)-5-acetylcyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 135297796 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | dimethyl (3R)-5-acetylcyclohexane-1,3-dicarboxylate |
| SMILES | COC(=O)C1CC(C(C)=O)C[C@@H](C(=O)OC)C1 |
| InChI | InChI=1S/C12H18O5/c1-7(13)8-4-9(11(14)16-2)6-10(5-8)12(15)17-3/h8-10H,4-6H2,1-3H3/t8?,9-,10?/m1/s1 |
| InChIKey | QHWDFTUWVRUPAA-HWOCKDDLSA-N |
| XLogP | 0.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |